C21H29F3N4S — CID 157022343
cis-(1S,3R)-1-N-(cyclohexylmethyl)-3-N-methyl-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclopentane-1,3-diamine (PubChem CID 157022343) has the molecular formula C21H29F3N4S and a molecular weight of 426.55 g/mol. Its IUPAC name is cis-(1S,3R)-1-N-(cyclohexylmethyl)-3-N-methyl-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclopentane-1,3-diamine.
| Compound Name | cis-(1S,3R)-1-N-(cyclohexylmethyl)-3-N-methyl-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 157022343 |
| Molecular Formula | C21H29F3N4S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | cis-(1S,3R)-1-N-(cyclohexylmethyl)-3-N-methyl-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclopentane-1,3-diamine |
| SMILES | CN(c1ncnc2sc(CC(F)(F)F)cc12)[C@@H]1CC[C@H](NCC2CCCCC2)C1 |
| InChI | InChI=1S/C21H29F3N4S/c1-28(16-8-7-15(9-16)25-12-14-5-3-2-4-6-14)19-18-10-17(11-21(22,23)24)29-20(18)27-13-26-19/h10,13-16,25H,2-9,11-12H2,1H3/t15-,16+/m0/s1 |
| InChIKey | HAKZSNJXAYKRBC-JKSUJKDBSA-N |
| XLogP | 5.32 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |