C15H17F3N4O4S — CID 166782935
[(1R,2S,3R,4S)-2,3-dihydroxy-4-[methyl-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentyl]carbamic acid (PubChem CID 166782935) has the molecular formula C15H17F3N4O4S and a molecular weight of 406.39 g/mol. Its IUPAC name is [(1R,2S,3R,4S)-2,3-dihydroxy-4-[methyl-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentyl]carbamic acid.
| Compound Name | [(1R,2S,3R,4S)-2,3-dihydroxy-4-[methyl-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentyl]carbamic acid |
|---|---|
| PubChem CID | 166782935 |
| Molecular Formula | C15H17F3N4O4S |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [(1R,2S,3R,4S)-2,3-dihydroxy-4-[methyl-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentyl]carbamic acid |
| SMILES | CN(c1ncnc2sc(CC(F)(F)F)cc12)[C@H]1C[C@@H](NC(=O)O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H17F3N4O4S/c1-22(9-3-8(21-14(25)26)10(23)11(9)24)12-7-2-6(4-15(16,17)18)27-13(7)20-5-19-12/h2,5,8-11,21,23-24H,3-4H2,1H3,(H,25,26)/t8-,9+,10+,11-/m1/s1 |
| InChIKey | YWYHIZBKPOXBIU-VPOLOUISSA-N |
| XLogP | 1.36 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |