C28H37F3N6O4S — CID 146636204
(1R,2S,4R)-4-[[4-(5,6-dimethoxypyridazin-3-yl)cyclohexyl]methylamino]-2-[[2-methoxy-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]cyclopentan-1-ol (PubChem CID 146636204) has the molecular formula C28H37F3N6O4S and a molecular weight of 610.70 g/mol. Its IUPAC name is (1R,2S,4R)-4-[[4-(5,6-dimethoxypyridazin-3-yl)cyclohexyl]methylamino]-2-[[2-methoxy-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]cyclopentan-1-ol.
| Compound Name | (1R,2S,4R)-4-[[4-(5,6-dimethoxypyridazin-3-yl)cyclohexyl]methylamino]-2-[[2-methoxy-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 146636204 |
| Molecular Formula | C28H37F3N6O4S |
| Molecular Weight | 610.70 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | (1R,2S,4R)-4-[[4-(5,6-dimethoxypyridazin-3-yl)cyclohexyl]methylamino]-2-[[2-methoxy-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]cyclopentan-1-ol |
| SMILES | COc1nc(N(C)[C@H]2C[C@@H](NCC3CCC(c4cc(OC)c(OC)nn4)CC3)C[C@H]2O)c2cc(CC(F)(F)F)sc2n1 |
| InChI | InChI=1S/C28H37F3N6O4S/c1-37(24-19-11-18(13-28(29,30)31)42-26(19)34-27(33-24)41-4)21-9-17(10-22(21)38)32-14-15-5-7-16(8-6-15)20-12-23(39-2)25(40-3)36-35-20/h11-12,15-17,21-22,32,38H,5-10,13-14H2,1-4H3/t15?,16?,17-,21+,22-/m1/s1 |
| InChIKey | NOEKSHSQVNBKBP-QAJMUUKDSA-N |
| XLogP | 4.50 |
| TPSA | 114.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.70 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |