C14H19BrN2O3 — CID 47480631
(2R)-N-(4-bromo-2-methoxy-6-methylphenyl)-2-(hydroxymethyl)pyrrolidine-1-carboxamide (PubChem CID 47480631) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is (2R)-N-(4-bromo-2-methoxy-6-methylphenyl)-2-(hydroxymethyl)pyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-(4-bromo-2-methoxy-6-methylphenyl)-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 47480631 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | (2R)-N-(4-bromo-2-methoxy-6-methylphenyl)-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
| SMILES | COc1cc(Br)cc(C)c1NC(=O)N1CCC[C@@H]1CO |
| InChI | InChI=1S/C14H19BrN2O3/c1-9-6-10(15)7-12(20-2)13(9)16-14(19)17-5-3-4-11(17)8-18/h6-7,11,18H,3-5,8H2,1-2H3,(H,16,19)/t11-/m1/s1 |
| InChIKey | PVATVJPUKLQGMZ-LLVKDONJSA-N |
| XLogP | 2.75 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |