C34H38N3O5+ — CID 4748659
4-[4-methoxy-3-[(4-methoxyphenoxy)methyl]phenyl]-2,7,7-trimethyl-N-(5-methylpyridin-1-ium-2-yl)-5-oxo-1,4,4a,6-tetrahydroquinoline-3-carboxamide (PubChem CID 4748659) has the molecular formula C34H38N3O5+ and a molecular weight of 568.69 g/mol. Its IUPAC name is 4-[4-methoxy-3-[(4-methoxyphenoxy)methyl]phenyl]-2,7,7-trimethyl-N-(5-methylpyridin-1-ium-2-yl)-5-oxo-1,4,4a,6-tetrahydroquinoline-3-carboxamide.
| Compound Name | 4-[4-methoxy-3-[(4-methoxyphenoxy)methyl]phenyl]-2,7,7-trimethyl-N-(5-methylpyridin-1-ium-2-yl)-5-oxo-1,4,4a,6-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 4748659 |
| Molecular Formula | C34H38N3O5+ |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | 4-[4-methoxy-3-[(4-methoxyphenoxy)methyl]phenyl]-2,7,7-trimethyl-N-(5-methylpyridin-1-ium-2-yl)-5-oxo-1,4,4a,6-tetrahydroquinoline-3-carboxamide |
| SMILES | COc1ccc(OCc2cc(C3C(C(=O)Nc4ccc(C)c[nH+]4)=C(C)NC4=CC(C)(C)CC(=O)C43)ccc2OC)cc1 |
| InChI | InChI=1S/C34H37N3O5/c1-20-7-14-29(35-18-20)37-33(39)30-21(2)36-26-16-34(3,4)17-27(38)32(26)31(30)22-8-13-28(41-6)23(15-22)19-42-25-11-9-24(40-5)10-12-25/h7-16,18,31-32,36H,17,19H2,1-6H3,(H,35,37,39)/p+1 |
| InChIKey | CUJKZVUENQUZQF-UHFFFAOYSA-O |
| XLogP | 5.50 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |