C33H35N4O5+ — CID 4749766
4-[3-[(2-carbamoylphenoxy)methyl]-4-methoxyphenyl]-2,7,7-trimethyl-5-oxo-N-pyridin-1-ium-2-yl-1,4,4a,6-tetrahydroquinoline-3-carboxamide (PubChem CID 4749766) has the molecular formula C33H35N4O5+ and a molecular weight of 567.67 g/mol. Its IUPAC name is 4-[3-[(2-carbamoylphenoxy)methyl]-4-methoxyphenyl]-2,7,7-trimethyl-5-oxo-N-pyridin-1-ium-2-yl-1,4,4a,6-tetrahydroquinoline-3-carboxamide.
| Compound Name | 4-[3-[(2-carbamoylphenoxy)methyl]-4-methoxyphenyl]-2,7,7-trimethyl-5-oxo-N-pyridin-1-ium-2-yl-1,4,4a,6-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 4749766 |
| Molecular Formula | C33H35N4O5+ |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | 4-[3-[(2-carbamoylphenoxy)methyl]-4-methoxyphenyl]-2,7,7-trimethyl-5-oxo-N-pyridin-1-ium-2-yl-1,4,4a,6-tetrahydroquinoline-3-carboxamide |
| SMILES | COc1ccc(C2C(C(=O)Nc3cccc[nH+]3)=C(C)NC3=CC(C)(C)CC(=O)C32)cc1COc1ccccc1C(N)=O |
| InChI | InChI=1S/C33H34N4O5/c1-19-28(32(40)37-27-11-7-8-14-35-27)29(30-23(36-19)16-33(2,3)17-24(30)38)20-12-13-25(41-4)21(15-20)18-42-26-10-6-5-9-22(26)31(34)39/h5-16,29-30,36H,17-18H2,1-4H3,(H2,34,39)(H,35,37,40)/p+1 |
| InChIKey | RSCMYSZIOXARLJ-UHFFFAOYSA-O |
| XLogP | 4.29 |
| TPSA | 133.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |