C16H11Cl2N3O3 — CID 47499607
2-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]benzamide (PubChem CID 47499607) has the molecular formula C16H11Cl2N3O3 and a molecular weight of 364.19 g/mol. Its IUPAC name is 2-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]benzamide.
| Compound Name | 2-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 47499607 |
| Molecular Formula | C16H11Cl2N3O3 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 2-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]benzamide |
| SMILES | NC(=O)c1ccccc1OCc1nnc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C16H11Cl2N3O3/c17-9-5-6-10(12(18)7-9)16-21-20-14(24-16)8-23-13-4-2-1-3-11(13)15(19)22/h1-7H,8H2,(H2,19,22) |
| InChIKey | UZKPCEIGSGSPKC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |