C15H16Cl2N4O2 — CID 75405374
N'-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]cyclopentanecarboximidamide (PubChem CID 75405374) has the molecular formula C15H16Cl2N4O2 and a molecular weight of 355.23 g/mol. Its IUPAC name is N'-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]cyclopentanecarboximidamide.
| Compound Name | N'-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]cyclopentanecarboximidamide |
|---|---|
| PubChem CID | 75405374 |
| Molecular Formula | C15H16Cl2N4O2 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N'-[[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]cyclopentanecarboximidamide |
| SMILES | N/C(=N/OCc1nnc(-c2ccc(Cl)cc2Cl)o1)C1CCCC1 |
| InChI | InChI=1S/C15H16Cl2N4O2/c16-10-5-6-11(12(17)7-10)15-20-19-13(23-15)8-22-21-14(18)9-3-1-2-4-9/h5-7,9H,1-4,8H2,(H2,18,21) |
| InChIKey | BTSZEPGCRCKGFC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|