C30H32N6O5 — CID 4750006
4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-7,7-dimethyl-2-methylidene-N-(4-methyl-2-pyridinyl)-5-oxo-3,4,6,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 4750006) has the molecular formula C30H32N6O5 and a molecular weight of 556.62 g/mol. Its IUPAC name is 4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-7,7-dimethyl-2-methylidene-N-(4-methyl-2-pyridinyl)-5-oxo-3,4,6,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | 4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-7,7-dimethyl-2-methylidene-N-(4-methyl-2-pyridinyl)-5-oxo-3,4,6,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 4750006 |
| Molecular Formula | C30H32N6O5 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 4-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]-7,7-dimethyl-2-methylidene-N-(4-methyl-2-pyridinyl)-5-oxo-3,4,6,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | C=C1NC2=C(C(=O)CC(C)(C)C2)C(c2ccc(OC)c(Cn3cc([N+](=O)[O-])cn3)c2)C1C(=O)Nc1cc(C)ccn1 |
| InChI | InChI=1S/C30H32N6O5/c1-17-8-9-31-25(10-17)34-29(38)26-18(2)33-22-12-30(3,4)13-23(37)28(22)27(26)19-6-7-24(41-5)20(11-19)15-35-16-21(14-32-35)36(39)40/h6-11,14,16,26-27,33H,2,12-13,15H2,1,3-5H3,(H,31,34,38) |
| InChIKey | JPPZLIXGQPCVRA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|