C27H28N4O2S — CID 4751529
N-(4-ethylphenyl)-2-[4-(4-ethylphenyl)-3-(phenoxymethyl)-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide (PubChem CID 4751529) has the molecular formula C27H28N4O2S and a molecular weight of 472.61 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[4-(4-ethylphenyl)-3-(phenoxymethyl)-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide.
| Compound Name | N-(4-ethylphenyl)-2-[4-(4-ethylphenyl)-3-(phenoxymethyl)-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 4751529 |
| Molecular Formula | C27H28N4O2S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-(4-ethylphenyl)-2-[4-(4-ethylphenyl)-3-(phenoxymethyl)-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide |
| SMILES | CCc1ccc(NC(=O)Cn2nc(COc3ccccc3)n(-c3ccc(CC)cc3)c2=S)cc1 |
| InChI | InChI=1S/C27H28N4O2S/c1-3-20-10-14-22(15-11-20)28-26(32)18-30-27(34)31(23-16-12-21(4-2)13-17-23)25(29-30)19-33-24-8-6-5-7-9-24/h5-17H,3-4,18-19H2,1-2H3,(H,28,32) |
| InChIKey | GVWFARXLCVCJRC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|