C27H28N4O2S — CID 4751497
N-(2,3-dimethylphenyl)-2-[4-(4-ethylphenyl)-3-(phenoxymethyl)-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide (PubChem CID 4751497) has the molecular formula C27H28N4O2S and a molecular weight of 472.61 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[4-(4-ethylphenyl)-3-(phenoxymethyl)-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[4-(4-ethylphenyl)-3-(phenoxymethyl)-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 4751497 |
| Molecular Formula | C27H28N4O2S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[4-(4-ethylphenyl)-3-(phenoxymethyl)-5-sulfanylidene-1,2,4-triazol-1-yl]acetamide |
| SMILES | CCc1ccc(-n2c(COc3ccccc3)nn(CC(=O)Nc3cccc(C)c3C)c2=S)cc1 |
| InChI | InChI=1S/C27H28N4O2S/c1-4-21-13-15-22(16-14-21)31-25(18-33-23-10-6-5-7-11-23)29-30(27(31)34)17-26(32)28-24-12-8-9-19(2)20(24)3/h5-16H,4,17-18H2,1-3H3,(H,28,32) |
| InChIKey | VTUCAAGTCIXELM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|