C21H23N5O2 — CID 4751761
4-(1,3-dimethylpyrazol-4-yl)-2-methylidene-5-oxo-N-pyridin-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide (PubChem CID 4751761) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 4-(1,3-dimethylpyrazol-4-yl)-2-methylidene-5-oxo-N-pyridin-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide.
| Compound Name | 4-(1,3-dimethylpyrazol-4-yl)-2-methylidene-5-oxo-N-pyridin-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 4751761 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 4-(1,3-dimethylpyrazol-4-yl)-2-methylidene-5-oxo-N-pyridin-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide |
| SMILES | C=C1NC2=C(C(=O)CCC2)C(c2cn(C)nc2C)C1C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C21H23N5O2/c1-12-14(11-26(3)25-12)19-18(21(28)24-17-9-4-5-10-22-17)13(2)23-15-7-6-8-16(27)20(15)19/h4-5,9-11,18-19,23H,2,6-8H2,1,3H3,(H,22,24,28) |
| InChIKey | RTBVWYCLIWGERJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |