C21H24N5O2+ — CID 4751757
2-methylidene-4-(1-methylpyrazol-4-yl)-N-(4-methylpyridin-1-ium-2-yl)-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide (PubChem CID 4751757) has the molecular formula C21H24N5O2+ and a molecular weight of 378.46 g/mol. Its IUPAC name is 2-methylidene-4-(1-methylpyrazol-4-yl)-N-(4-methylpyridin-1-ium-2-yl)-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide.
| Compound Name | 2-methylidene-4-(1-methylpyrazol-4-yl)-N-(4-methylpyridin-1-ium-2-yl)-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 4751757 |
| Molecular Formula | C21H24N5O2+ |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-methylidene-4-(1-methylpyrazol-4-yl)-N-(4-methylpyridin-1-ium-2-yl)-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide |
| SMILES | C=C1NC2=C(C(=O)CCC2)C(c2cnn(C)c2)C1C(=O)Nc1cc(C)cc[nH+]1 |
| InChI | InChI=1S/C21H23N5O2/c1-12-7-8-22-17(9-12)25-21(28)18-13(2)24-15-5-4-6-16(27)20(15)19(18)14-10-23-26(3)11-14/h7-11,18-19,24H,2,4-6H2,1,3H3,(H,22,25,28)/p+1 |
| InChIKey | QRCCOVAPCPISMX-UHFFFAOYSA-O |
| XLogP | 2.01 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |