C30H30N3O2S+ — CID 4748880
2-methylidene-N-(3-methylpyridin-1-ium-2-yl)-4-(4-methylsulfanylphenyl)-5-oxo-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide (PubChem CID 4748880) has the molecular formula C30H30N3O2S+ and a molecular weight of 496.66 g/mol. Its IUPAC name is 2-methylidene-N-(3-methylpyridin-1-ium-2-yl)-4-(4-methylsulfanylphenyl)-5-oxo-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide.
| Compound Name | 2-methylidene-N-(3-methylpyridin-1-ium-2-yl)-4-(4-methylsulfanylphenyl)-5-oxo-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 4748880 |
| Molecular Formula | C30H30N3O2S+ |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 2-methylidene-N-(3-methylpyridin-1-ium-2-yl)-4-(4-methylsulfanylphenyl)-5-oxo-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide |
| SMILES | C=C1NC2=C(C(=O)CC(c3ccccc3)C2)C(c2ccc(SC)cc2)C1C(=O)Nc1[nH+]cccc1C |
| InChI | InChI=1S/C30H29N3O2S/c1-18-8-7-15-31-29(18)33-30(35)26-19(2)32-24-16-22(20-9-5-4-6-10-20)17-25(34)28(24)27(26)21-11-13-23(36-3)14-12-21/h4-15,22,26-27,32H,2,16-17H2,1,3H3,(H,31,33,35)/p+1 |
| InChIKey | LPKRVQGKRXOOFL-UHFFFAOYSA-O |
| XLogP | 5.39 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |