C32H27ClN3O3+ — CID 4749690
4-[5-(3-chlorophenyl)furan-2-yl]-2-methylidene-5-oxo-7-phenyl-N-pyridin-1-ium-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide (PubChem CID 4749690) has the molecular formula C32H27ClN3O3+ and a molecular weight of 537.04 g/mol. Its IUPAC name is 4-[5-(3-chlorophenyl)furan-2-yl]-2-methylidene-5-oxo-7-phenyl-N-pyridin-1-ium-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide.
| Compound Name | 4-[5-(3-chlorophenyl)furan-2-yl]-2-methylidene-5-oxo-7-phenyl-N-pyridin-1-ium-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 4749690 |
| Molecular Formula | C32H27ClN3O3+ |
| Molecular Weight | 537.04 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 4-[5-(3-chlorophenyl)furan-2-yl]-2-methylidene-5-oxo-7-phenyl-N-pyridin-1-ium-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxamide |
| SMILES | C=C1NC2=C(C(=O)CC(c3ccccc3)C2)C(c2ccc(-c3cccc(Cl)c3)o2)C1C(=O)Nc1cccc[nH+]1 |
| InChI | InChI=1S/C32H26ClN3O3/c1-19-29(32(38)36-28-12-5-6-15-34-28)31(27-14-13-26(39-27)21-10-7-11-23(33)16-21)30-24(35-19)17-22(18-25(30)37)20-8-3-2-4-9-20/h2-16,22,29,31,35H,1,17-18H2,(H,34,36,38)/p+1 |
| InChIKey | KATNXJBRAPZSLN-UHFFFAOYSA-O |
| XLogP | 6.27 |
| TPSA | 85.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.04 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |