C14H18ClN5O — CID 47525513
(4-chloro-1H-pyrrol-2-yl)-[4-(2-pyrazol-1-ylethyl)piperazin-1-yl]methanone (PubChem CID 47525513) has the molecular formula C14H18ClN5O and a molecular weight of 307.78 g/mol. Its IUPAC name is (4-chloro-1H-pyrrol-2-yl)-[4-(2-pyrazol-1-ylethyl)piperazin-1-yl]methanone.
| Compound Name | (4-chloro-1H-pyrrol-2-yl)-[4-(2-pyrazol-1-ylethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 47525513 |
| Molecular Formula | C14H18ClN5O |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (4-chloro-1H-pyrrol-2-yl)-[4-(2-pyrazol-1-ylethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)c[nH]1)N1CCN(CCn2cccn2)CC1 |
| InChI | InChI=1S/C14H18ClN5O/c15-12-10-13(16-11-12)14(21)19-7-4-18(5-8-19)6-9-20-3-1-2-17-20/h1-3,10-11,16H,4-9H2 |
| InChIKey | OLHVKVAHFYLUCX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 57.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |