C13H15ClN4O — CID 95344276
(4-chloro-1H-pyrrol-2-yl)-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 95344276) has the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. Its IUPAC name is (4-chloro-1H-pyrrol-2-yl)-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-chloro-1H-pyrrol-2-yl)-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95344276 |
| Molecular Formula | C13H15ClN4O |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (4-chloro-1H-pyrrol-2-yl)-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)c[nH]1)N1CCC[C@H]1Cn1cccn1 |
| InChI | InChI=1S/C13H15ClN4O/c14-10-7-12(15-8-10)13(19)18-6-1-3-11(18)9-17-5-2-4-16-17/h2,4-5,7-8,11,15H,1,3,6,9H2/t11-/m0/s1 |
| InChIKey | QCTAWMUIKWEJTK-NSHDSACASA-N |
| XLogP | 2.17 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |