C17H18N4O — CID 95343101
1H-indol-6-yl-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 95343101) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 1H-indol-6-yl-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | 1H-indol-6-yl-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95343101 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1H-indol-6-yl-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc2cc[nH]c2c1)N1CCC[C@H]1Cn1cccn1 |
| InChI | InChI=1S/C17H18N4O/c22-17(14-5-4-13-6-8-18-16(13)11-14)21-10-1-3-15(21)12-20-9-2-7-19-20/h2,4-9,11,15,18H,1,3,10,12H2/t15-/m0/s1 |
| InChIKey | XAZVZINLWWYZEF-HNNXBMFYSA-N |
| XLogP | 2.67 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |