C18H24N4O — CID 95603955
[4-[(dimethylamino)methyl]phenyl]-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 95603955) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is [4-[(dimethylamino)methyl]phenyl]-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [4-[(dimethylamino)methyl]phenyl]-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95603955 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | [4-[(dimethylamino)methyl]phenyl]-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | CN(C)Cc1ccc(C(=O)N2CCC[C@@H]2Cn2cccn2)cc1 |
| InChI | InChI=1S/C18H24N4O/c1-20(2)13-15-6-8-16(9-7-15)18(23)22-12-3-5-17(22)14-21-11-4-10-19-21/h4,6-11,17H,3,5,12-14H2,1-2H3/t17-/m1/s1 |
| InChIKey | JAAAIBNQQRPQHL-QGZVFWFLSA-N |
| XLogP | 2.25 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |