C23H27N5O2 — CID 4752702
3-(2-methoxyphenyl)-1-[(4-methylphenyl)methyl]-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)urea (PubChem CID 4752702) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1-[(4-methylphenyl)methyl]-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)urea.
| Compound Name | 3-(2-methoxyphenyl)-1-[(4-methylphenyl)methyl]-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)urea |
|---|---|
| PubChem CID | 4752702 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 3-(2-methoxyphenyl)-1-[(4-methylphenyl)methyl]-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)urea |
| SMILES | COc1ccccc1NC(=O)N(Cc1ccc(C)cc1)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C23H27N5O2/c1-17-11-13-18(14-12-17)16-28(22-26-25-21-10-4-3-7-15-27(21)22)23(29)24-19-8-5-6-9-20(19)30-2/h5-6,8-9,11-14H,3-4,7,10,15-16H2,1-2H3,(H,24,29) |
| InChIKey | OSGRFENNHJLPCN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |