C22H23Cl2N5O2 — CID 27451077
3-(3,4-dichlorophenyl)-1-(2-methoxyphenyl)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea (PubChem CID 27451077) has the molecular formula C22H23Cl2N5O2 and a molecular weight of 460.37 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-(2-methoxyphenyl)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-(2-methoxyphenyl)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 27451077 |
| Molecular Formula | C22H23Cl2N5O2 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-(2-methoxyphenyl)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
| SMILES | COc1ccccc1N(Cc1nnc2n1CCCCC2)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H23Cl2N5O2/c1-31-19-8-5-4-7-18(19)29(22(30)25-15-10-11-16(23)17(24)13-15)14-21-27-26-20-9-3-2-6-12-28(20)21/h4-5,7-8,10-11,13H,2-3,6,9,12,14H2,1H3,(H,25,30) |
| InChIKey | BWGDKOYXPAKWMD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |