C19H27N5O2 — CID 7566060
1-(2-ethoxyphenyl)-3-ethyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea (PubChem CID 7566060) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-ethyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea.
| Compound Name | 1-(2-ethoxyphenyl)-3-ethyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 7566060 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-ethyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
| SMILES | CCNC(=O)N(Cc1nnc2n1CCCCC2)c1ccccc1OCC |
| InChI | InChI=1S/C19H27N5O2/c1-3-20-19(25)24(15-10-7-8-11-16(15)26-4-2)14-18-22-21-17-12-6-5-9-13-23(17)18/h7-8,10-11H,3-6,9,12-14H2,1-2H3,(H,20,25) |
| InChIKey | OMPKRWADIJMWIY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |