C22H24ClN5O — CID 7565861
1-(3-chlorophenyl)-3-(2-methylphenyl)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea (PubChem CID 7565861) has the molecular formula C22H24ClN5O and a molecular weight of 409.92 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(2-methylphenyl)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea.
| Compound Name | 1-(3-chlorophenyl)-3-(2-methylphenyl)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 7565861 |
| Molecular Formula | C22H24ClN5O |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(2-methylphenyl)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
| SMILES | Cc1ccccc1NC(=O)N(Cc1nnc2n1CCCCC2)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H24ClN5O/c1-16-8-4-5-11-19(16)24-22(29)28(18-10-7-9-17(23)14-18)15-21-26-25-20-12-3-2-6-13-27(20)21/h4-5,7-11,14H,2-3,6,12-13,15H2,1H3,(H,24,29) |
| InChIKey | VTKZNWXYHDMVIJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |