C19H23NO6 — CID 4752871
diethyl 4-(3,4-dihydroxyphenyl)-6-methyl-2-methylidene-3,4-dihydro-1H-pyridine-3,5-dicarboxylate (PubChem CID 4752871) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is diethyl 4-(3,4-dihydroxyphenyl)-6-methyl-2-methylidene-3,4-dihydro-1H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-(3,4-dihydroxyphenyl)-6-methyl-2-methylidene-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 4752871 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | diethyl 4-(3,4-dihydroxyphenyl)-6-methyl-2-methylidene-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
| SMILES | C=C1NC(C)=C(C(=O)OCC)C(c2ccc(O)c(O)c2)C1C(=O)OCC |
| InChI | InChI=1S/C19H23NO6/c1-5-25-18(23)15-10(3)20-11(4)16(19(24)26-6-2)17(15)12-7-8-13(21)14(22)9-12/h7-9,15,17,20-22H,3,5-6H2,1-2,4H3 |
| InChIKey | PDMMIUFUVKJLAK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|