C21H28N2O4 — CID 4754038
diethyl 4-[4-(dimethylamino)phenyl]-6-methyl-2-methylidene-3,4-dihydro-1H-pyridine-3,5-dicarboxylate (PubChem CID 4754038) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is diethyl 4-[4-(dimethylamino)phenyl]-6-methyl-2-methylidene-3,4-dihydro-1H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-[4-(dimethylamino)phenyl]-6-methyl-2-methylidene-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 4754038 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | diethyl 4-[4-(dimethylamino)phenyl]-6-methyl-2-methylidene-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
| SMILES | C=C1NC(C)=C(C(=O)OCC)C(c2ccc(N(C)C)cc2)C1C(=O)OCC |
| InChI | InChI=1S/C21H28N2O4/c1-7-26-20(24)17-13(3)22-14(4)18(21(25)27-8-2)19(17)15-9-11-16(12-10-15)23(5)6/h9-12,17,19,22H,3,7-8H2,1-2,4-6H3 |
| InChIKey | VNTDVWQDQQZVAN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|