C22H19N2O4S+ — CID 4753038
4-(3-methoxybenzoyl)-1-(pyridin-1-ium-3-ylmethyl)-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 4753038) has the molecular formula C22H19N2O4S+ and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-(3-methoxybenzoyl)-1-(pyridin-1-ium-3-ylmethyl)-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | 4-(3-methoxybenzoyl)-1-(pyridin-1-ium-3-ylmethyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4753038 |
| Molecular Formula | C22H19N2O4S+ |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 4-(3-methoxybenzoyl)-1-(pyridin-1-ium-3-ylmethyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | COc1cccc(C(=O)C2C(=O)C(=O)N(Cc3ccc[nH+]c3)C2c2cccs2)c1 |
| InChI | InChI=1S/C22H18N2O4S/c1-28-16-7-2-6-15(11-16)20(25)18-19(17-8-4-10-29-17)24(22(27)21(18)26)13-14-5-3-9-23-12-14/h2-12,18-19H,13H2,1H3/p+1 |
| InChIKey | GNBQUTSSBHEJAD-UHFFFAOYSA-O |
| XLogP | 2.72 |
| TPSA | 77.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|