C23H23N4O4+ — CID 4753077
1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4-(3-methoxybenzoyl)-5-pyridin-4-ylpyrrolidine-2,3-dione (PubChem CID 4753077) has the molecular formula C23H23N4O4+ and a molecular weight of 419.46 g/mol. Its IUPAC name is 1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4-(3-methoxybenzoyl)-5-pyridin-4-ylpyrrolidine-2,3-dione.
| Compound Name | 1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4-(3-methoxybenzoyl)-5-pyridin-4-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4753077 |
| Molecular Formula | C23H23N4O4+ |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4-(3-methoxybenzoyl)-5-pyridin-4-ylpyrrolidine-2,3-dione |
| SMILES | COc1cccc(C(=O)C2C(=O)C(=O)N(CCC[n+]3cc[nH]c3)C2c2ccncc2)c1 |
| InChI | InChI=1S/C23H22N4O4/c1-31-18-5-2-4-17(14-18)21(28)19-20(16-6-8-24-9-7-16)27(23(30)22(19)29)12-3-11-26-13-10-25-15-26/h2,4-10,13-15,19-20H,3,11-12H2,1H3/p+1 |
| InChIKey | YQYHXOSNOABSSG-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|