C26H28N3O6+ — CID 5133971
5-(2,5-dimethoxyphenyl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione (PubChem CID 5133971) has the molecular formula C26H28N3O6+ and a molecular weight of 478.53 g/mol. Its IUPAC name is 5-(2,5-dimethoxyphenyl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione.
| Compound Name | 5-(2,5-dimethoxyphenyl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5133971 |
| Molecular Formula | C26H28N3O6+ |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 5-(2,5-dimethoxyphenyl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione |
| SMILES | COc1cccc(C(O)=C2C(=O)C(=O)N(CCC[n+]3cc[nH]c3)C2c2cc(OC)ccc2OC)c1 |
| InChI | InChI=1S/C26H27N3O6/c1-33-18-7-4-6-17(14-18)24(30)22-23(20-15-19(34-2)8-9-21(20)35-3)29(26(32)25(22)31)12-5-11-28-13-10-27-16-28/h4,6-10,13-16,23H,5,11-12H2,1-3H3,(H,30,31)/p+1 |
| InChIKey | DETDUKGNUMHRLD-UHFFFAOYSA-O |
| XLogP | 2.84 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|