C28H32N3O6+ — CID 44656739
(4E)-5-(4-ethoxy-3-methoxyphenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione (PubChem CID 44656739) has the molecular formula C28H32N3O6+ and a molecular weight of 506.58 g/mol. Its IUPAC name is (4E)-5-(4-ethoxy-3-methoxyphenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-ethoxy-3-methoxyphenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 44656739 |
| Molecular Formula | C28H32N3O6+ |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (4E)-5-(4-ethoxy-3-methoxyphenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(CCC[n+]3cc[nH]c3)C2c2ccc(OCC)c(OC)c2)cc1 |
| InChI | InChI=1S/C28H31N3O6/c1-4-36-21-10-7-19(8-11-21)26(32)24-25(20-9-12-22(37-5-2)23(17-20)35-3)31(28(34)27(24)33)15-6-14-30-16-13-29-18-30/h7-13,16-18,25H,4-6,14-15H2,1-3H3,(H,32,33)/p+1 |
| InChIKey | LIUGVWTXJABNHX-UHFFFAOYSA-O |
| XLogP | 3.62 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|