C28H31N3O6 — CID 4654402
[1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(3-methoxy-4-propoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(4-methoxyphenyl)methanolate (PubChem CID 4654402) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is [1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(3-methoxy-4-propoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(4-methoxyphenyl)methanolate.
| Compound Name | [1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(3-methoxy-4-propoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(4-methoxyphenyl)methanolate |
|---|---|
| PubChem CID | 4654402 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | [1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(3-methoxy-4-propoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(4-methoxyphenyl)methanolate |
| SMILES | CCCOc1ccc(C2C(=C([O-])c3ccc(OC)cc3)C(=O)C(=O)N2CCC[n+]2cc[nH]c2)cc1OC |
| InChI | InChI=1S/C28H31N3O6/c1-4-16-37-22-11-8-20(17-23(22)36-3)25-24(26(32)19-6-9-21(35-2)10-7-19)27(33)28(34)31(25)14-5-13-30-15-12-29-18-30/h6-12,15,17-18,25H,4-5,13-14,16H2,1-3H3,(H,32,33) |
| InChIKey | VJYJRZMNJUENBL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|