C28H31N3O5 — CID 6150920
(E)-[2-(3,4-diethoxyphenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(4-methylphenyl)methanolate (PubChem CID 6150920) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is (E)-[2-(3,4-diethoxyphenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(4-methylphenyl)methanolate.
| Compound Name | (E)-[2-(3,4-diethoxyphenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(4-methylphenyl)methanolate |
|---|---|
| PubChem CID | 6150920 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | (E)-[2-(3,4-diethoxyphenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(4-methylphenyl)methanolate |
| SMILES | CCOc1ccc(C2/C(=C(\[O-])c3ccc(C)cc3)C(=O)C(=O)N2CCC[n+]2cc[nH]c2)cc1OCC |
| InChI | InChI=1S/C28H31N3O5/c1-4-35-22-12-11-21(17-23(22)36-5-2)25-24(26(32)20-9-7-19(3)8-10-20)27(33)28(34)31(25)15-6-14-30-16-13-29-18-30/h7-13,16-18,25H,4-6,14-15H2,1-3H3,(H,32,33) |
| InChIKey | JQQQUTGWVDJRKJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|