C27H29ClN3O5+ — CID 5128315
4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3,4-diethoxyphenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione (PubChem CID 5128315) has the molecular formula C27H29ClN3O5+ and a molecular weight of 511.00 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3,4-diethoxyphenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione.
| Compound Name | 4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3,4-diethoxyphenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5128315 |
| Molecular Formula | C27H29ClN3O5+ |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3,4-diethoxyphenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(C2C(=C(O)c3ccc(Cl)cc3)C(=O)C(=O)N2CCC[n+]2cc[nH]c2)cc1OCC |
| InChI | InChI=1S/C27H28ClN3O5/c1-3-35-21-11-8-19(16-22(21)36-4-2)24-23(25(32)18-6-9-20(28)10-7-18)26(33)27(34)31(24)14-5-13-30-15-12-29-17-30/h6-12,15-17,24H,3-5,13-14H2,1-2H3,(H,32,33)/p+1 |
| InChIKey | JRBIPFQOWUEQBO-UHFFFAOYSA-O |
| XLogP | 4.26 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|