C29H34N3O6+ — CID 44655204
(4E)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-(3-methoxy-4-propoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 44655204) has the molecular formula C29H34N3O6+ and a molecular weight of 520.61 g/mol. Its IUPAC name is (4E)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-(3-methoxy-4-propoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-(3-methoxy-4-propoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 44655204 |
| Molecular Formula | C29H34N3O6+ |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | (4E)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-(3-methoxy-4-propoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1ccc(C2/C(=C(\O)c3ccc(OCC)cc3)C(=O)C(=O)N2CCC[n+]2cc[nH]c2)cc1OC |
| InChI | InChI=1S/C29H33N3O6/c1-4-17-38-23-12-9-21(18-24(23)36-3)26-25(27(33)20-7-10-22(11-8-20)37-5-2)28(34)29(35)32(26)15-6-14-31-16-13-30-19-31/h7-13,16,18-19,26H,4-6,14-15,17H2,1-3H3,(H,33,34)/p+1 |
| InChIKey | UBXLPJGVLCUVND-UHFFFAOYSA-O |
| XLogP | 4.01 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|