C25H25BrN3O5+ — CID 44655534
(4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione (PubChem CID 44655534) has the molecular formula C25H25BrN3O5+ and a molecular weight of 527.40 g/mol. Its IUPAC name is (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 44655534 |
| Molecular Formula | C25H25BrN3O5+ |
| Molecular Weight | 527.40 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2/C(=C(\O)c3ccc(Br)cc3)C(=O)C(=O)N2CCC[n+]2cc[nH]c2)cc1OC |
| InChI | InChI=1S/C25H24BrN3O5/c1-33-19-9-6-17(14-20(19)34-2)22-21(23(30)16-4-7-18(26)8-5-16)24(31)25(32)29(22)12-3-11-28-13-10-27-15-28/h4-10,13-15,22H,3,11-12H2,1-2H3,(H,30,31)/p+1 |
| InChIKey | XALGSZXYPYSEJZ-UHFFFAOYSA-O |
| XLogP | 3.59 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|