C25H26BrNO7 — CID 98321903
6-[(2R,3E)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(3,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]hexanoic acid (PubChem CID 98321903) has the molecular formula C25H26BrNO7 and a molecular weight of 532.39 g/mol. Its IUPAC name is 6-[(2R,3E)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(3,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]hexanoic acid.
| Compound Name | 6-[(2R,3E)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(3,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 98321903 |
| Molecular Formula | C25H26BrNO7 |
| Molecular Weight | 532.39 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | 6-[(2R,3E)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(3,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]hexanoic acid |
| SMILES | COc1ccc([C@@H]2/C(=C(\O)c3ccc(Br)cc3)C(=O)C(=O)N2CCCCCC(=O)O)cc1OC |
| InChI | InChI=1S/C25H26BrNO7/c1-33-18-12-9-16(14-19(18)34-2)22-21(23(30)15-7-10-17(26)11-8-15)24(31)25(32)27(22)13-5-3-4-6-20(28)29/h7-12,14,22,30H,3-6,13H2,1-2H3,(H,28,29)/b23-21+/t22-/m1/s1 |
| InChIKey | OGPACRMKZKZWFX-HOGKFDNTSA-N |
| XLogP | 4.53 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|