C28H31ClN3O4+ — CID 3936373
4-[(3-chloro-4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione (PubChem CID 3936373) has the molecular formula C28H31ClN3O4+ and a molecular weight of 509.03 g/mol. Its IUPAC name is 4-[(3-chloro-4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(3-chloro-4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3936373 |
| Molecular Formula | C28H31ClN3O4+ |
| Molecular Weight | 509.03 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 4-[(3-chloro-4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(C(O)=C2C(=O)C(=O)N(CCC[n+]3cc[nH]c3)C2c2ccc(C(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C28H30ClN3O4/c1-4-36-23-11-10-21(16-22(23)29)26(33)24-25(20-8-6-19(7-9-20)18(2)3)32(28(35)27(24)34)14-5-13-31-15-12-30-17-31/h6-12,15-18,25H,4-5,13-14H2,1-3H3,(H,33,34)/p+1 |
| InChIKey | SOYNESDWRFIHOT-UHFFFAOYSA-O |
| XLogP | 4.99 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.03 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|