C31H35N3O7 — CID 4977741
2,3-dihydro-1,4-benzodioxin-6-yl-[1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-[3-methoxy-4-(3-methylbutoxy)phenyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate (PubChem CID 4977741) has the molecular formula C31H35N3O7 and a molecular weight of 561.64 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl-[1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-[3-methoxy-4-(3-methylbutoxy)phenyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl-[1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-[3-methoxy-4-(3-methylbutoxy)phenyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 4977741 |
| Molecular Formula | C31H35N3O7 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl-[1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-[3-methoxy-4-(3-methylbutoxy)phenyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate |
| SMILES | COc1cc(C2C(=C([O-])c3ccc4c(c3)OCCO4)C(=O)C(=O)N2CCC[n+]2cc[nH]c2)ccc1OCCC(C)C |
| InChI | InChI=1S/C31H35N3O7/c1-20(2)9-14-39-23-7-5-21(17-25(23)38-3)28-27(29(35)22-6-8-24-26(18-22)41-16-15-40-24)30(36)31(37)34(28)12-4-11-33-13-10-32-19-33/h5-8,10,13,17-20,28H,4,9,11-12,14-16H2,1-3H3,(H,35,36) |
| InChIKey | CSKTTYSYDRKOTK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|