C24H23ClN3O3+ — CID 4754234
5-(4-chlorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4-(4-methylbenzoyl)pyrrolidine-2,3-dione (PubChem CID 4754234) has the molecular formula C24H23ClN3O3+ and a molecular weight of 436.92 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4-(4-methylbenzoyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(4-chlorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4-(4-methylbenzoyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4754234 |
| Molecular Formula | C24H23ClN3O3+ |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 5-(4-chlorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4-(4-methylbenzoyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C(=O)C2C(=O)C(=O)N(CCC[n+]3cc[nH]c3)C2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H22ClN3O3/c1-16-3-5-18(6-4-16)22(29)20-21(17-7-9-19(25)10-8-17)28(24(31)23(20)30)13-2-12-27-14-11-26-15-27/h3-11,14-15,20-21H,2,12-13H2,1H3/p+1 |
| InChIKey | LTZIKZWLRLWZAB-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 74.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|