C23H16BrFN2O3 — CID 4754908
5-(4-bromophenyl)-4-(4-fluorobenzoyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 4754908) has the molecular formula C23H16BrFN2O3 and a molecular weight of 467.29 g/mol. Its IUPAC name is 5-(4-bromophenyl)-4-(4-fluorobenzoyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(4-bromophenyl)-4-(4-fluorobenzoyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4754908 |
| Molecular Formula | C23H16BrFN2O3 |
| Molecular Weight | 467.29 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | 5-(4-bromophenyl)-4-(4-fluorobenzoyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2cccnc2)C(c2ccc(Br)cc2)C1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H16BrFN2O3/c24-17-7-3-15(4-8-17)20-19(21(28)16-5-9-18(25)10-6-16)22(29)23(30)27(20)13-14-2-1-11-26-12-14/h1-12,19-20H,13H2 |
| InChIKey | AKENEPMBTOPBLY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|