C18H22O4S — CID 47561427
1-(3-methylphenoxy)-3-[(4-methylphenyl)methylsulfonyl]propan-2-ol (PubChem CID 47561427) has the molecular formula C18H22O4S and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-(3-methylphenoxy)-3-[(4-methylphenyl)methylsulfonyl]propan-2-ol.
| Compound Name | 1-(3-methylphenoxy)-3-[(4-methylphenyl)methylsulfonyl]propan-2-ol |
|---|---|
| PubChem CID | 47561427 |
| Molecular Formula | C18H22O4S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 1-(3-methylphenoxy)-3-[(4-methylphenyl)methylsulfonyl]propan-2-ol |
| SMILES | Cc1ccc(CS(=O)(=O)CC(O)COc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C18H22O4S/c1-14-6-8-16(9-7-14)12-23(20,21)13-17(19)11-22-18-5-3-4-15(2)10-18/h3-10,17,19H,11-13H2,1-2H3 |
| InChIKey | FKDXIKCHXWYFDD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |