C30H30N6O8S4 — CID 4756464
6-[5-[3-[6-(2-nitroanilino)-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-nitrophenyl)hexanamide (PubChem CID 4756464) has the molecular formula C30H30N6O8S4 and a molecular weight of 730.87 g/mol. Its IUPAC name is 6-[5-[3-[6-(2-nitroanilino)-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-nitrophenyl)hexanamide.
| Compound Name | 6-[5-[3-[6-(2-nitroanilino)-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-nitrophenyl)hexanamide |
|---|---|
| PubChem CID | 4756464 |
| Molecular Formula | C30H30N6O8S4 |
| Molecular Weight | 730.87 g/mol |
| Exact Mass | 730.10 |
| IUPAC Name | 6-[5-[3-[6-(2-nitroanilino)-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-nitrophenyl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)C(=C2SC(=S)N(CCCCCC(=O)Nc3ccccc3[N+](=O)[O-])C2=O)SC1=S)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H30N6O8S4/c37-23(31-19-11-5-7-13-21(19)35(41)42)15-3-1-9-17-33-27(39)25(47-29(33)45)26-28(40)34(30(46)48-26)18-10-2-4-16-24(38)32-20-12-6-8-14-22(20)36(43)44/h5-8,11-14H,1-4,9-10,15-18H2,(H,31,37)(H,32,38) |
| InChIKey | KXPCFBYWLGMJOA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 185.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.87 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|