C29H42N4O4S4 — CID 4756471
5-[4-oxo-3-(6-oxo-6-piperidin-1-ylhexyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-3-(7-oxo-7-piperidin-1-ylheptyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4756471) has the molecular formula C29H42N4O4S4 and a molecular weight of 638.95 g/mol. Its IUPAC name is 5-[4-oxo-3-(6-oxo-6-piperidin-1-ylhexyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-3-(7-oxo-7-piperidin-1-ylheptyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[4-oxo-3-(6-oxo-6-piperidin-1-ylhexyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-3-(7-oxo-7-piperidin-1-ylheptyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4756471 |
| Molecular Formula | C29H42N4O4S4 |
| Molecular Weight | 638.95 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | 5-[4-oxo-3-(6-oxo-6-piperidin-1-ylhexyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-3-(7-oxo-7-piperidin-1-ylheptyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C(CCCCCCN1C(=O)C(=C2SC(=S)N(CCCCCC(=O)N3CCCCC3)C2=O)SC1=S)N1CCCCC1 |
| InChI | InChI=1S/C29H42N4O4S4/c34-22(30-16-8-4-9-17-30)14-6-1-2-12-20-32-26(36)24(40-28(32)38)25-27(37)33(29(39)41-25)21-13-3-7-15-23(35)31-18-10-5-11-19-31/h1-21H2 |
| InChIKey | KHFNFAVTRCTNBB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.95 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|