C17H23N3O6 — CID 47592628
[4-(ethylcarbamoylamino)cyclohexyl] 2-methoxy-5-nitrobenzoate (PubChem CID 47592628) has the molecular formula C17H23N3O6 and a molecular weight of 365.39 g/mol. Its IUPAC name is [4-(ethylcarbamoylamino)cyclohexyl] 2-methoxy-5-nitrobenzoate.
| Compound Name | [4-(ethylcarbamoylamino)cyclohexyl] 2-methoxy-5-nitrobenzoate |
|---|---|
| PubChem CID | 47592628 |
| Molecular Formula | C17H23N3O6 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | [4-(ethylcarbamoylamino)cyclohexyl] 2-methoxy-5-nitrobenzoate |
| SMILES | CCNC(=O)NC1CCC(OC(=O)c2cc([N+](=O)[O-])ccc2OC)CC1 |
| InChI | InChI=1S/C17H23N3O6/c1-3-18-17(22)19-11-4-7-13(8-5-11)26-16(21)14-10-12(20(23)24)6-9-15(14)25-2/h6,9-11,13H,3-5,7-8H2,1-2H3,(H2,18,19,22) |
| InChIKey | FNKAEUXUHSCXQG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|