C30H28ClN5O5S3 — CID 4759689
5-[(4-chlorophenyl)methylidene]-3-[6-[4-[5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperazin-1-yl]-6-oxohexyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4759689) has the molecular formula C30H28ClN5O5S3 and a molecular weight of 670.24 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methylidene]-3-[6-[4-[5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperazin-1-yl]-6-oxohexyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(4-chlorophenyl)methylidene]-3-[6-[4-[5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperazin-1-yl]-6-oxohexyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4759689 |
| Molecular Formula | C30H28ClN5O5S3 |
| Molecular Weight | 670.24 g/mol |
| Exact Mass | 669.09 |
| IUPAC Name | 5-[(4-chlorophenyl)methylidene]-3-[6-[4-[5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperazin-1-yl]-6-oxohexyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1N=C(N2CCN(C(=O)CCCCCN3C(=O)C(=Cc4ccc(Cl)cc4)SC3=S)CC2)SC1=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H28ClN5O5S3/c31-22-9-5-20(6-10-22)19-25-28(39)35(30(42)44-25)13-3-1-2-4-26(37)33-14-16-34(17-15-33)29-32-27(38)24(43-29)18-21-7-11-23(12-8-21)36(40)41/h5-12,18-19H,1-4,13-17H2 |
| InChIKey | ULTSLUXCNZPQFZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 116.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.24 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|