C26H30N2O2S2 — CID 4760263
N-(1-adamantyl)-4-(5-cinnamylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)butanamide (PubChem CID 4760263) has the molecular formula C26H30N2O2S2 and a molecular weight of 466.67 g/mol. Its IUPAC name is N-(1-adamantyl)-4-(5-cinnamylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)butanamide.
| Compound Name | N-(1-adamantyl)-4-(5-cinnamylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)butanamide |
|---|---|
| PubChem CID | 4760263 |
| Molecular Formula | C26H30N2O2S2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N-(1-adamantyl)-4-(5-cinnamylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)C(=CC=Cc2ccccc2)SC1=S)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H30N2O2S2/c29-23(27-26-15-19-12-20(16-26)14-21(13-19)17-26)10-5-11-28-24(30)22(32-25(28)31)9-4-8-18-6-2-1-3-7-18/h1-4,6-9,19-21H,5,10-17H2,(H,27,29) |
| InChIKey | MTTSTRCYURDCAE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|