C23H21BrN2O2S2 — CID 4760331
N-(3-bromophenyl)-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 4760331) has the molecular formula C23H21BrN2O2S2 and a molecular weight of 501.47 g/mol. Its IUPAC name is N-(3-bromophenyl)-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-(3-bromophenyl)-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 4760331 |
| Molecular Formula | C23H21BrN2O2S2 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 500.02 |
| IUPAC Name | N-(3-bromophenyl)-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | CC(=Cc1ccccc1)C=C1SC(=S)N(CCCC(=O)Nc2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C23H21BrN2O2S2/c1-16(13-17-7-3-2-4-8-17)14-20-22(28)26(23(29)30-20)12-6-11-21(27)25-19-10-5-9-18(24)15-19/h2-5,7-10,13-15H,6,11-12H2,1H3,(H,25,27) |
| InChIKey | TXGDIALTBXAWTA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|