C23H19N2O5S2- — CID 54721325
2-carboxy-4-[3-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]phenolate (PubChem CID 54721325) has the molecular formula C23H19N2O5S2- and a molecular weight of 467.55 g/mol. Its IUPAC name is 2-carboxy-4-[3-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]phenolate.
| Compound Name | 2-carboxy-4-[3-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]phenolate |
|---|---|
| PubChem CID | 54721325 |
| Molecular Formula | C23H19N2O5S2- |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 2-carboxy-4-[3-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]phenolate |
| SMILES | CC(=Cc1ccccc1)C=C1SC(=S)N(CCC(=O)Nc2ccc([O-])c(C(=O)O)c2)C1=O |
| InChI | InChI=1S/C23H20N2O5S2/c1-14(11-15-5-3-2-4-6-15)12-19-21(28)25(23(31)32-19)10-9-20(27)24-16-7-8-18(26)17(13-16)22(29)30/h2-8,11-13,26H,9-10H2,1H3,(H,24,27)(H,29,30)/p-1 |
| InChIKey | OYELAKCKFJSWAV-UHFFFAOYSA-M |
| XLogP | 3.63 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|