C23H20N2O4S2 — CID 6996078
2-[3-[(5Z)-5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid (PubChem CID 6996078) has the molecular formula C23H20N2O4S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-[3-[(5Z)-5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid.
| Compound Name | 2-[3-[(5Z)-5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 6996078 |
| Molecular Formula | C23H20N2O4S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 2-[3-[(5Z)-5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
| SMILES | CC(=Cc1ccccc1)/C=C1\SC(=S)N(CCC(=O)Nc2ccccc2C(=O)O)C1=O |
| InChI | InChI=1S/C23H20N2O4S2/c1-15(13-16-7-3-2-4-8-16)14-19-21(27)25(23(30)31-19)12-11-20(26)24-18-10-6-5-9-17(18)22(28)29/h2-10,13-14H,11-12H2,1H3,(H,24,26)(H,28,29)/b15-13?,19-14- |
| InChIKey | HIAOTRJVQZHDIR-IVHAVKBASA-N |
| XLogP | 4.56 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|