C28H32N2O2S2 — CID 4760407
N-benzyl-N-tert-butyl-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 4760407) has the molecular formula C28H32N2O2S2 and a molecular weight of 492.71 g/mol. Its IUPAC name is N-benzyl-N-tert-butyl-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-benzyl-N-tert-butyl-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 4760407 |
| Molecular Formula | C28H32N2O2S2 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | N-benzyl-N-tert-butyl-4-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | CC(=Cc1ccccc1)C=C1SC(=S)N(CCCC(=O)N(Cc2ccccc2)C(C)(C)C)C1=O |
| InChI | InChI=1S/C28H32N2O2S2/c1-21(18-22-12-7-5-8-13-22)19-24-26(32)29(27(33)34-24)17-11-16-25(31)30(28(2,3)4)20-23-14-9-6-10-15-23/h5-10,12-15,18-19H,11,16-17,20H2,1-4H3 |
| InChIKey | QMVSMXVNHGZNOF-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|