C18H11NO6S2 — CID 4760595
5-[5-[3-(furan-2-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzene-1,3-dicarboxylic acid (PubChem CID 4760595) has the molecular formula C18H11NO6S2 and a molecular weight of 401.42 g/mol. Its IUPAC name is 5-[5-[3-(furan-2-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[5-[3-(furan-2-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 4760595 |
| Molecular Formula | C18H11NO6S2 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 5-[5-[3-(furan-2-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(N2C(=O)C(=CC=Cc3ccco3)SC2=S)c1 |
| InChI | InChI=1S/C18H11NO6S2/c20-15-14(5-1-3-13-4-2-6-25-13)27-18(26)19(15)12-8-10(16(21)22)7-11(9-12)17(23)24/h1-9H,(H,21,22)(H,23,24) |
| InChIKey | ZZUYOTBZGXYBKU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|